1951-25-3 Amiodarone
| product Name |
Amiodarone |
| CAS No |
1951-25-3 |
| Synonyms |
Amiodarone Base; Methanone, (2-butyl-3-benzofuranyl)(4-(2-(diethylamino)ethoxy)-3,5-diiodophenyl)-; ; (2-butyl-1-benzofuran-3-yl){4-[2-(diethylamino)ethoxy]-3,5-diiodophenyl}methanone; 2-{4-[(2-butyl-1-benzofuran-3-yl)carbonyl]-2,6-diiodophenoxy}-N,N-diethylethanaminium chloride |
| Molecular Formula |
C25H30ClI2NO3 |
| Molecular Weight |
681.7725 |
| InChI |
InChI=1/C25H29I2NO3.ClH/c1-4-7-11-22-23(18-10-8-9-12-21(18)31-22)24(29)17-15-19(26)25(20(27)16-17)30-14-13-28(5-2)6-3;/h8-10,12,15-16H,4-7,11,13-14H2,1-3H3;1H |
| EINECS |
217-772-1 |
| Molecular Structure |
|
| Boiling point |
635.1°C at 760 mmHg |
| Flash point |
337.9°C |
| Vapour Pressur |
4.95E-16mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R20/21/22:;
|
| Safety Description |
S36:;
|
|
Featured China Suppliers
| Telephone |
+86-510-82303030 |
| Email |
sales@cidic.com.cn |
| Address |
15/F, HODO International Plaza, 531 Zhongshan Road, Wuxi, Jinagsu, China |
| Specifications |
99% up |
| Packing |
25kg/drum |
| Description |
Introduction: 1. Amiodarone hydrochloride 2. CAS:1951-25-3 3. Quality:EP6 GMP 4. Appearance:white powder 5. Use:anti-arrhythmia drug Function: 1. Pharmaceuticals Amiodarone hcl 2. Dietary Supplement, such as capsules or tablets. Application: Amiodarone hydrochloride is a class III antiarrhythmic agent used for various types of cardiac dysrhythmias, both ventricular and atrial. |
| Contact |
Xie Wen Feng |
| Telephone |
+86-592-5881089 |
| Email |
xie@china-sinoway.com |
| Address |
16/F,Huicheng Comm,Complex,No839 XiaHe Rd, Xiamen,China |