1499-10-1 9,10-Diphenylanthracene
| product Name |
9,10-Diphenylanthracene |
| CAS No |
1499-10-1 |
| Synonyms |
DPA; 9,10-diphenyl-anthracen; anthracene,9,10-diphenyl-; 9,10-diphenylanthracen; 9,10-DIPHENYLENEANTHRACENE OEKANAL, 250; Bis(2,4,6-Trichlorophenyl)EthanedioateTcpo; 9,10-Diphenylanthracene(blue) (DPA); 9,10-Diphenylanthracene, scintillation; DPHA |
| Molecular Formula |
C26H18 |
| Molecular Weight |
330.4211 |
| InChI |
InChI=1/C26H18/c1-3-11-19(12-4-1)25-21-15-7-9-17-23(21)26(20-13-5-2-6-14-20)24-18-10-8-16-22(24)25/h1-18H |
| EINECS |
216-105-1 |
| Molecular Structure |
|
| Density |
1.146g/cm3 |
| Melting point |
245-248℃ |
| Boiling point |
469.1°C at 760 mmHg |
| Refractive index |
1.697 |
| Flash point |
234.7°C |
| Water solubility |
INSOLUBLE |
| Vapour Pressur |
1.59E-08mmHg at 25°C |
| Risk Codes |
2811:;
|
| Safety Description |
S24/25:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Mrs Zhuge |
| Telephone |
+86-571-88092925 88093529 |
| Email |
sunyb2007@hotmail.com |
| Address |
368 Dengyun Road, Hangzhou, Zhejiang, China |
| Telephone |
+86-21-33926680 |
| Email |
sales@shdynamic.com |
| Address |
Room 805,Information Tower No.1403 Minsheng Road,Pudong New Area, Shanghai 200135, P. R. China |
| Contact |
Gao Xing |
| Telephone |
+86-519-86536539;13606148116 |
| Email |
sales@minghuangchem.com |
| Address |
Minghuang Town,Wujin, Changzhou, JiangSu, China |
| Telephone |
+86-21-58995482 58995483 58995476 |
| Email |
chem@tricocn.com |
| Address |
1506 Room,No.1399 Jinqiao Road,Pudong New District,Shanghai China |
| Specifications |
white powder or crystal |
| Description |
Melting point: 81-82 ?C Boiling point: 343 ?C Assay: 99%(WT.) min. |
| Telephone |
+86-536-5102364,5103738 |
| Email |
export@shouguangpharm.com |
| Address |
North-East of Dongwaihuan Road, Dongcheng Industrial Area??Shouguang City??Shandong Province??P.R. of China |