ChemNet > CAS > 1138-60-9 isopropyl 3,4,5-trihydroxybenzoate
1138-60-9 isopropyl 3,4,5-trihydroxybenzoate
| product Name |
isopropyl 3,4,5-trihydroxybenzoate |
| CAS No |
1138-60-9 |
| Synonyms |
Isopropyl gallate; Gallic acid isopropyl ester; propan-2-yl 3,4,5-trihydroxybenzoate; Isopropylgallate |
| Molecular Formula |
C10H12O5 |
| Molecular Weight |
212.1993 |
| InChI |
InChI=1/C10H12O5/c1-5(2)15-10(14)6-3-7(11)9(13)8(12)4-6/h3-5,11-13H,1-2H3 |
| EINECS |
214-515-5 |
| Molecular Structure |
|
| Density |
1.36g/cm3 |
| Boiling point |
439.5°C at 760 mmHg |
| Refractive index |
1.593 |
| Flash point |
177.4°C |
| Vapour Pressur |
2.47E-08mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
Featured China Suppliers
| Telephone |
+86-21-58526349 |
| Email |
DZTECHEMI@ALIYUN.COM |
| Address |
Rm 302, 23#, Lane 308, Yushan Rd., Pudong, Shanghai, China |