100-06-1 4'-Methoxyacetophenone
| product Name |
4'-Methoxyacetophenone |
| CAS No |
100-06-1 |
| Synonyms |
p-Acetanisole; p-Acetylanisole; 4-Methoxyacetophenone; 4-Methoxy Acetophenone; 1-(4-methoxyphenyl)ethanone; P-methoxy acetophone; Acetanisole |
| Molecular Formula |
C9H10O2 |
| Molecular Weight |
150.1745 |
| InChI |
InChI=1/C9H10O2/c1-7(10)8-3-5-9(11-2)6-4-8/h3-6H,1-2H3 |
| EINECS |
202-815-9 |
| Molecular Structure |
|
| Density |
1.035g/cm3 |
| Melting point |
36-39℃ |
| Boiling point |
256.4°C at 760 mmHg |
| Refractive index |
1.504 |
| Flash point |
113.2°C |
| Water solubility |
insoluble |
| Vapour Pressur |
0.0155mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R22:;
R36/38:;
|
| Safety Description |
S26:;
S37/39:;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Jiang Biao |
| Telephone |
+86-25-83479682 |
| Email |
paul@3cchem.com |
| Address |
Room 2107, Li??ao Building, No.323, Zhongyang Road,Nanjing City, Jiangsu Province, China. |
| Contact |
TRANCY LIN |
| Telephone |
0086-571-88808190 /81396135 |
| Email |
sales@gbchemwin.com |
| Address |
Floor 12th, Trendway Building, No.3688, Jiangnan Avenue, Binjiang District,? Hangzhou City,Zhejiang Province,310053,P.R.China |
| Contact |
Chang Cheng; Yan Zhenyu |
| Telephone |
+86-25-58392388-600 |
| Email |
yanliuxin@sinohighchem.com |
| Address |
No. 51 Chongfu Road,Nanjing Chemical Industrial Park,Nanjing City 210047,China |
| Specifications |
99.5% white crystal |
| Packing |
200kg/drum |
| Description |
Product name:4-methoxyacetophenone Cas No. : 100-06-1 Purity:99.5% Appearance: White Crystal Packing: 200kg/drum Usage:used in the preparation of flavors, commonly used in advanced cosmetics and soap spices, but also for organic synthesis |
| Contact |
Susan Xu |
| Telephone |
+86-531-82312885 15990993651 |
| Email |
yudong@yudong.com.cn |
| Address |
32 North Shanda Road,Jinan,Shandong,China |
| Contact |
Vanessa Sun |
| Telephone |
0632-5819808 |
| Email |
export1@xiangyuanaroma.com; info@xiangyuanaroma.com |
| Address |
No. 3888, Mid College Road, Tengzhou, Shandong, PRC. |