ChemNet > CAS > 9010-85-9 Poly(isobutylen-co-isopren)
9010-85-9 Poly(isobutylen-co-isopren)
| Produkt-Name |
Poly(isobutylen-co-isopren) |
| Synonyme |
Isobutylen/Isopren-Copolymer; 2-Methyl-1,3-butadien-Polymer mit 2-Methyl-1-propen; Butylkautschuk; 1,3-Butadien,2-methyl-, Polymer mit 2-Methyl-1-propen; Poly(isobutylen-co-isopren); 2-Methylbuta-1,3-dien-2-methylprop-1-en (1:1) |
| Englischer Name |
poly(isobutylene-co-isoprene);Isobutylene/isoprene copolymer; 2-Methyl-1,3-butadiene polymer with 2-methyl-1-propene; Butyl rubber; 1,3-Butadiene, 2-methyl-, polymer with 2-methyl-1-propene; Poly(isobutylene-co-isoprene); 2-methylbuta-1,3-diene - 2-methylprop-1-ene (1:1) |
| Molekulare Formel |
C9H16 |
| Molecular Weight |
124.2233 |
| InChI |
InChI=1/C5H8.C4H8/c1-4-5(2)3;1-4(2)3/h4H,1-2H2,3H3;1H2,2-3H3 |
| CAS Registry Number |
9010-85-9 |
| Molecular Structure |
|
| Siedepunkt |
34.1°C at 760 mmHg |
| Dampfdruck |
549mmHg at 25°C |
|