610-69-5 2-Nitrophenylacetat
| Produkt-Name |
2-Nitrophenylacetat |
| Synonyme |
2-Nitrophenylacetat; Essigs?ure-2-nitrophenylester |
| Englischer Name |
2-nitrophenyl acetate; 2-Nitrophenyl acetate; Acetic acid 2-nitrophenyl ester |
| Molekulare Formel |
C8H7NO4 |
| Molecular Weight |
181.1455 |
| InChI |
InChI=1/C8H7NO4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3 |
| CAS Registry Number |
610-69-5 |
| EINECS |
210-233-1 |
| Molecular Structure |
|
| Dichte |
1.304g/cm3 |
| Schmelzpunkt |
39-41℃ |
| Siedepunkt |
274.8°C at 760 mmHg |
| Brechungsindex |
1.548 |
| Flammpunkt |
139.8°C |
| Dampfdruck |
0.00528mmHg at 25°C |
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|