ChemNet > CAS > 4265-57-0 Methylenbis(3-Thiopropions?ure)
4265-57-0 Methylenbis(3-Thiopropions?ure)
| Produkt-Name |
Methylenbis(3-Thiopropions?ure) |
| Synonyme |
3,3'-(Methylenbis(thio))bispropions?ure |
| Englischer Name |
Methylenebis(3-thiopropionic acid);3,3'-(Methylenebis(thio))bispropionic acid |
| Molekulare Formel |
C7H12O4S2 |
| Molecular Weight |
224.2978 |
| InChI |
InChI=1/C7H12O4S2/c8-6(9)4(2-12)1-5(3-13)7(10)11/h4-5,12-13H,1-3H2,(H,8,9)(H,10,11) |
| CAS Registry Number |
4265-57-0 |
| EINECS |
224-251-2 |
| Molecular Structure |
|
| Brechungsindex |
1.571 |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|