4228-00-6 Phenyllaurat
| Produkt-Name |
Phenyllaurat |
| Synonyme |
;D Odecans?ure-Phenylester ~ Phenyldodecanoat; Phenyldodecanoat |
| Englischer Name |
Phenyl laurate; Dodecanoic acid phenyl ester~Phenyl dodecanoate; phenyl dodecanoate |
| Molekulare Formel |
C18H28O2 |
| Molecular Weight |
276.4137 |
| InChI |
InChI=1/C18H28O2/c1-2-3-4-5-6-7-8-9-13-16-18(19)20-17-14-11-10-12-15-17/h10-12,14-15H,2-9,13,16H2,1H3 |
| CAS Registry Number |
4228-00-6 |
| EINECS |
224-178-6 |
| Molecular Structure |
|
| Dichte |
0.946g/cm3 |
| Siedepunkt |
366.5°C at 760 mmHg |
| Brechungsindex |
1.486 |
| Flammpunkt |
123.9°C |
| Dampfdruck |
1.46E-05mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|