ChemNet > CAS > 324-42-5 2-Fluor-6-methylnaphthalin
324-42-5 2-Fluor-6-methylnaphthalin
| Produkt-Name |
2-Fluor-6-methylnaphthalin |
| Englischer Name |
2-fluoro-6-methylnaphthalene; |
| Molekulare Formel |
C11H9F |
| Molecular Weight |
160.1876 |
| InChI |
InChI=1/C11H9F/c1-8-2-3-10-7-11(12)5-4-9(10)6-8/h2-7H,1H3 |
| CAS Registry Number |
324-42-5 |
| Molecular Structure |
|
| Dichte |
1.112g/cm3 |
| Schmelzpunkt |
72℃ |
| Siedepunkt |
247.5°C at 760 mmHg |
| Brechungsindex |
1.594 |
| Flammpunkt |
84.5°C |
| Dampfdruck |
0.0403mmHg at 25°C |
| Gefahrensymbole |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|