1122-60-7 Nitrocyclohexan
| Produkt-Name |
Nitrocyclohexan |
| Synonyme |
; Hexahydronitrobenzol |
| Englischer Name |
nitrocyclohexane; Hexahydronitrobenzene |
| Molekulare Formel |
C6H11NO2 |
| Molecular Weight |
129.157 |
| InChI |
InChI=1/C6H11NO2/c8-7(9)6-4-2-1-3-5-6/h6H,1-5H2 |
| CAS Registry Number |
1122-60-7 |
| EINECS |
214-354-0 |
| Molecular Structure |
|
| Dichte |
1.05g/cm3 |
| Siedepunkt |
202.8°C at 760 mmHg |
| Brechungsindex |
1.465 |
| Flammpunkt |
81.2°C |
| Dampfdruck |
0.287mmHg at 25°C |
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|