3404-61-3 3-methyl-1-hexen
| název vyrobku |
3-methyl-1-hexen |
| Synonyma |
; 1-hexen, 3-methyl-; 222-283-1; 3-methylhex-1-en |
| Anglicky název |
3-Methyl-1-hexene; 1-hexene, 3-methyl-; 222-283-1; 3-methylhex-1-ene |
| Molekulární vzorec |
C7H14 |
| Molekulová hmotnost |
98.1861 |
| InChI |
InChI=1/C7H14/c1-4-6-7(3)5-2/h5,7H,2,4,6H2,1,3H3 |
| Registra?ní ?íslo CAS |
3404-61-3 |
| EINECS |
222-283-1 |
| Molekulární struktura |
|
| Hustota |
0.703g/cm3 |
| Bod varu |
85.4°C at 760 mmHg |
| Index lomu |
1.404 |
| Tlak par |
77.8mmHg at 25°C |
| Symbol? nebezpe?nosti |
F:Highly flammable;
Xi:Irritant;
|
| Riziko Codes |
R11:Highly flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpe?nostní Popis |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|