| Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
| CAS NO: |
65-85-0 |
| EC NO: |
200-618-2 |
| Molecular Formula: |
C7H6O2 |
| Molecular Weight: |
122.1224 |
| Specification: |
|
| InChI: |
InChI=1/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9)/p-1 |
Product description:
Benzoic acid CAS: 65-85-0 Formula: C7H6O2 Benzenecarboxylic acid Phenyl carboxylic acid Dracylic acid PubChem: 243 EC (EINECS/ELINCS): 200-618-2 RTECS: DG0875000 UN: 9094 Merck: 13,1092 Beilstein/Gmelin: 636131 Beilstein Reference: 4-09-00-00273 EPA OPP: 9101
|
| Synonyms: |
Melting point standard benzoic acid;Benzoic-12C7 acid, 13C-depleted;Benzoic acid, USP Grade;4-Carboxypolystyrene;benzoate;Industrial-use benzoic acid;Natural Benzoic acid; |
| Molecular Structure: |
 |