Details for Ethyl 4-acetyl-5-oxohexanoate

Ethyl 4-acetyl-5-oxohexanoate
| Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
| CAS NO: |
2832-10-2 |
| EC NO: |
|
| Molecular Formula: |
C10H16O4 |
| Molecular Weight: |
200.2316 |
| Specification: |
|
| InChI: |
InChI=1/C10H16O4/c1-4-14-10(13)6-5-9(7(2)11)8(3)12/h11H,4-6H2,1-3H3/b9-7+ |
| Synonyms: |
Ethyl 4,4-diacetylbutyrate;4-Acetyl-5-oxohexanoic acid ethyl ester;2-(Ethoxycarbonylethyl)acetylacetone~Ethyl 4,4-diacetylbutyrate;ethyl (4E)-4-acetyl-5-hydroxyhex-4-enoate; |
| Molecular Structure: |
 |
if you are sourcing Ethyl 4-acetyl-5-oxohexanoate from United-States ,just feel free to inquire