Details for Polyurethane

Polyurethane
| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
9009-54-5 |
| EC NO: |
210-898-8 |
| Molecular Formula: |
C3H8N2O |
| Molecular Weight: |
88.1084 |
| Specification: |
|
| InChI: |
InChI=1/C3H8N2O/c1-2-5-3(4)6/h2H2,1H3,(H3,4,5,6) |
| Synonyms: |
Polyurethane foam;Polyurethane foams;Polyisocyanurate resins;Polyurethanes, cellular;PU foam;The following companies react isocyanates or prepolymers with polyols to produce polyurethane foams. The list is incomplete.;POLYURETHANEOLIGOMERS;POLYURETHANEVARNISH;PU;Acrylic polyurethane paint;Acrylic polyurethane anticorrosive coating;Polyurethane mixed component;1-ethylurea; |
| Molecular Structure: |
 |
if you are sourcing Polyurethane from South-Korea ,just feel free to inquire