Details for Acetophenone

Acetophenone
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
98-86-2 |
| EC NO: |
202-708-7 |
| Molecular Formula: |
C8H8O |
| Molecular Weight: |
120.15 |
| Specification: |
|
| InChI: |
InChI=1/C8H8O/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H3 |
Product description:
;Used for olefin polymerization catalysts, solvents, used in the manufacture of spices, etc; |
| Synonyms: |
Methyl phenyl ketone;1-Phenylethanone;alpha-Acetophenone;1-Phenyl-1-ethanone;phenyl methyl ketone; |
| Molecular Structure: |
 |
if you are sourcing Acetophenone from Japan ,just feel free to inquire