Details for Para Nitro Chloro Benzene

Para Nitro Chloro Benzene
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
100-00-5 |
| EC NO: |
202-809-6 |
| Molecular Formula: |
C6H4ClNO2 |
| Molecular Weight: |
157.5545 |
| Specification: |
|
| InChI: |
InChI=1/C6H4ClNO2/c7-5-1-3-6(4-2-5)8(9)10/h1-4H |
| Synonyms: |
p-Nitrochlorobenzene;4-Nitrochlorobenzene;P-Nitro chloro benzene;p-chloronitrobenzene;4-Chloronitrobenzene;N,N,4-trimethylaniline;Para Nitrochloro Benzene; |
| Molecular Structure: |
 |
if you are sourcing Para Nitro Chloro Benzene from India ,just feel free to inquire