Details for Levulinic Acid

Levulinic Acid
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
123-76-2 |
| EC NO: |
204-649-2 |
| Molecular Formula: |
C5H7O3 |
| Molecular Weight: |
115.1078 |
| Specification: |
|
| InChI: |
InChI=1/C5H8O3/c1-4(6)2-3-5(7)8/h2-3H2,1H3,(H,7,8)/p-1 |
| Synonyms: |
4-Oxopentanoic acid;Levulinic acid,(4-Ketopentanoic acid;4-Oxopentanoic acid);4-oxovaleric acid;laevulic acid;Levulic Acid;4-Ketopentanoic acid;calcium bis(4-oxopentanoate);2-methyl-3-oxobutanoic acid;sodium 4-oxopentanoate;4-oxopentanoate; |
| Molecular Structure: |
 |
if you are sourcing Levulinic Acid from India ,just feel free to inquire