| Category: |
Pharmaceuticals and Biochemicals |
|
| CAS NO: |
50-48-6 |
| EC NO: |
200-041-6 |
| Molecular Formula: |
C20H23NNa |
| Molecular Weight: |
300.3931 |
| Specification: |
|
| InChI: |
InChI=1/C20H23N.Na.H/c1-21(2)15-7-12-20-18-10-5-3-8-16(18)13-14-17-9-4-6-11-19(17)20;;/h3-6,8-12H,7,13-15H2,1-2H3;;/rC20H23N.HNa/c1-21(2)15-7-12-20-18-10-5-3-8-16(18)13-14-17-9-4-6-11-19(17)20;/h3-6,8-12H,7,13-15H2,1-2H3;1H |
Product description:
Chemical splash goggles in compliance with OSHA regulations are advised; however, OSHA regulations also permit other type safety glasses. Whre chemical resistant gloves. To prevent repeated or prolonged skin contact, wear impervious clothing and boots.
|
| Synonyms: |
3-(10,11-dihydrodibenzo(a,d)cyclohepten-5-ylidene)propyldimethylamine; |
| Molecular Structure: |
 |