Details for Gabapentin

Gabapentin
| Category: |
Intermediates |
|
| CAS NO: |
60142-96-3 |
| EC NO: |
262-076-3 |
| Molecular Formula: |
C9H17NO2 |
| Molecular Weight: |
171.2368 |
| Specification: |
|
| InChI: |
InChI=1/C9H17NO2/c10-6-8-4-2-1-3-7(8)5-9(11)12/h7-8H,1-6,10H2,(H,11,12) |
Product description:
Anticonvulsant with unknown mechanism of action. Exhibits antinociceptive, anxiolytic, neuroprotective and anti-epileptic effects.
|
| Synonyms: |
neurontin;1-(aminomethyl)cyclohexaneacetic acid;GABAPENTINE;(1-aminomethyl-cyclohexyl)-acetic acid;AKOS 92109;[2-(aminomethyl)cyclohexyl]acetic acid;Capecitabin; |
| Molecular Structure: |
 |
if you are sourcing Gabapentin from India ,just feel free to inquire