Details for Benzyl Isobutyrate

Benzyl Isobutyrate
| Category: |
Fragrances and Aroma chemicals |
|
| CAS NO: |
103-28-6 |
| EC NO: |
203-095-9 |
| Molecular Formula: |
C11H14O2 |
| Molecular Weight: |
178.2277 |
| Specification: |
|
| InChI: |
InChI=1/C11H14O2/c1-9(2)11(12)13-8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| Synonyms: |
Benzyl isobutyrate;Isobutyric acid benzyl ester;Isobutyric acid benzyl ester;benzyl 2-methylpropanoate;Benzyl isobutanoate; |
| Molecular Structure: |
 |
if you are sourcing Benzyl Isobutyrate from India ,just feel free to inquire