| Category: |
|
|
| CAS NO: |
85-44-9 |
| EC NO: |
201-607-5 |
| Molecular Formula: |
C8H4O3 |
| Molecular Weight: |
148.12 |
| Specification: |
|
| InChI: |
InChI=1/C16H10O7/c17-13(18)9-5-1-3-7-11(9)15(21)23-16(22)12-8-4-2-6-10(12)14(19)20/h1-8H,(H,17,18)(H,19,20) |
Product description:
Phthalic Anhydride is an important aromatic Di-Carboxylic Acid Anhydride, which is widely used in the manufacture of Alkyd Resins for Paints, Inks and Coatings, Unsaturated Polyester Resins, Plasticizers and Pigments. |
| Synonyms: |
2,5-Isobenzofurandione;2-benzofuran-1,3-dione;2,2'-(oxydicarbonyl)dibenzoic acid;o-Phthalic anhydride; |
| Molecular Structure: |
 |