Details for Blue 2B

Blue 2B
| Category: |
Dyestuffs and Pigments/Direct Dyes |
|
| CAS NO: |
116-75-6 |
| EC NO: |
204-155-7 |
| Molecular Formula: |
C32H30N2O2 |
| Molecular Weight: |
474.5928 |
| Specification: |
|
| InChI: |
InChI=1/C32H30N2O2/c1-17-13-19(3)29(20(4)14-17)33-25-11-12-26(34-30-21(5)15-18(2)16-22(30)6)28-27(25)31(35)23-9-7-8-10-24(23)32(28)36/h7-16,33-34H,1-6H3 |
| Synonyms: |
C.I. 61568;C.I. Solvent Blue 104;Solvent Blue 104;Transparent Blue 2B;C.I.Solvent Blue 104;Blue 2B;1,4-bis[(2,4,6-trimethylphenyl)amino]anthracene-9,10-dione;C.I.Solvent Blue104; |
| Molecular Structure: |
 |
if you are sourcing Blue 2B from India ,just feel free to inquire