Details for 4 Fluoro Benzyl Amine

4 Fluoro Benzyl Amine
| Category: |
Organic chemicals and Derivatives/Aroma compounds |
|
| CAS NO: |
140-75-0 |
| EC NO: |
205-430-4 |
| Molecular Formula: |
C7H3F2NS |
| Molecular Weight: |
171.1672 |
| Specification: |
|
| InChI: |
InChI=1/C7H3F2NS/c8-5-1-2-7(10-4-11)6(9)3-5/h1-3H |
| Synonyms: |
4-Fluorbenzylamine;4-fluoroBenzenemethanamine;1-(4-fluorophenyl)methanamine;(4-fluorophenyl)methanaminium;2,4-difluoro-1-isothiocyanatobenzene;Fluorobenzyl amine;(4-Fluorophenyl)methanamine;4-fluoro-benzenemethanamin;P-Fluorobenzyl Amine; |
| Molecular Structure: |
 |
if you are sourcing 4 Fluoro Benzyl Amine from India ,just feel free to inquire