Details for Soybean Extract

Soybean Extract
| Category: |
Pharmaceuticals and Biochemicals/Herbal Plant Extract |
|
| CAS NO: |
574-12-9 |
| EC NO: |
|
| Molecular Formula: |
C15H10O2 |
| Molecular Weight: |
222.2387 |
| Specification: |
|
| InChI: |
InChI=1/C15H10O2/c16-15-12-8-4-5-9-14(12)17-10-13(15)11-6-2-1-3-7-11/h1-10H |
| Synonyms: |
Soy Isoflavone;SOY ISOFLAVONES;Soybean Isoflavones P.E.;Soybeanisoflavone;3-phenyl-4H-chromen-4-one;Soybean Extract;Soybean Isoflavones;Soybean Isoflavones Extract Powder;isoflavones in soy; |
| Molecular Structure: |
 |
if you are sourcing Soybean Extract from China ,just feel free to inquire