| Category: |
Adhesives and Sealants/Woodworking Adhesives |
|
| CAS NO: |
64-19-7 |
| EC NO: |
200-580-7 |
| Molecular Formula: |
C2H4O2 |
| Molecular Weight: |
60.05 |
| Specification: |
|
| InChI: |
InChI=1/C2H4O2/c1-2(3)4/h1H3,(H,3,4) |
| Packing: |
215kg/drum |
Product description:
Molecular Formula:CH3COOH |
| Uses: |
1. It's one of the most important organic material. 2. It is mainly used in manufacturing of vinyl acetate, acetic anhydride, acetic ester, acetate, ethyl cellu lose, and chloro acetic acid. 3. It can also be used in the field of synthetic fiber, bin |
| Synonyms: |
Glacial acetic acid;Acetic Acid Glacial BP;Natural Acetic Acid;Acetic Acid Glacial;GAA;Acetic Acid, Glacial;Ethanoic acid;Acetasol; |
| Molecular Structure: |
 |