Details for 1,3-dichloro-2-methylbenzene

1,3-dichloro-2-methylbenzene
| Category: |
Agrochemicals/Chemical fertilizers |
|
| CAS NO: |
118-69-4 |
| EC NO: |
204-269-7 |
| Molecular Formula: |
C7H6Cl2 |
| Molecular Weight: |
161.0285 |
| Specification: |
2,6-Dichlorotoluene |
| InChI: |
InChI=1/C7H6Cl2/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
| Packing: |
250kg/drum |
Product description:
Molecular Formula:C7H6Cl2 |
| Uses: |
For Agrochemical Intermediates and Pharmaceutical Intermediates |
| Synonyms: |
Benzene, 1,3-dichloro-2-methyl-; 2,6-DCT;1,3-dichloro-2-methylbenzene; |
| Molecular Structure: |
 |
if you are sourcing 1,3-dichloro-2-methylbenzene from China ,just feel free to inquire