Details for 2,4-Dichlorobromobenzene

2,4-Dichlorobromobenzene
| Category: |
Intermediates/Others |
|
| CAS NO: |
1193-72-2 |
| EC NO: |
214-778-6 |
| Molecular Formula: |
C6H3BrCl2 |
| Molecular Weight: |
225.898 |
| Specification: |
GC≥98.0% |
| InChI: |
InChI=1/C6H3BrCl2/c7-5-2-1-4(8)3-6(5)9/h1-3H |
| Packing: |
on request |
Product description:
Chemical Name:2,4-Dichlorobromobenzene
CAS No. 1193-72-2
Content: GC≥98.0%
Appearance: colorless to light yellow liquid
Packing: on request;
Productivity: 5Tons/M
|
| Uses: |
intermediates |
| Synonyms: |
1-BROMO-2,4-DICHLOROBENZENE; |
| Molecular Structure: |
 |
if you are sourcing 2,4-Dichlorobromobenzene from China ,just feel free to inquire