| Category: |
Intermediates/Flavor and fragrance intermediates |
|
| CAS NO: |
123-11-5 |
| EC NO: |
204-602-6 |
| Molecular Formula: |
C8H8O2 |
| Molecular Weight: |
136.1479 |
| Specification: |
99% |
| InChI: |
InChI=1/C8H8O2/c1-10-8-4-2-7(6-9)3-5-8/h2-6H,1H3 |
| Packing: |
50kg / drum;225kg/drum |
Product description:
|
CHECK POINT |
UNIT |
SPECIFICATIONS |
|
Appearance |
-- |
Colorless to light yellow clear liquid |
|
Odor |
-- |
Camellia scent |
|
Purity |
% min |
99 |
|
Relative Density |
@25°C.g/ml |
1.115 - 1.123 |
|
Refraction |
@20℃ |
1.571 - 1.574 |
|
Acid Value |
mg KOH/g max |
5 |
|
| Uses: |
Perfumery and toilet soaps; odor resembles that of coumarin, but the aldehyde must be mixed with other odorous substances to yield an agreeable odor. Also used in organic syntheses. |
| Synonyms: |
AnisaldehydeMetoxybenzaldehyd;aubepine;Anisaldehyde;4-Methoxybenzaldehyde;4-Methoxybenzylaldehyde;Anisic Aldehyde;p-methoxybenzaldehyde;4-methoxy-benzaldehyd;Anisal;Benzaldehyde,4-methoxy-;Methyl-p-oxybenzaldehyde;Obepin;p-Formylanisole;p-Methoxybenzafdehyde;PARA Anisaldehyde;PARA Anisic Aldehyde;P-Anisic Aldehyde;FEMA 2670;AUBE'PINE;Anisaldehyde,4-;Anisic Aldehyde-P;LABOTEST-BB LT00920037;4-Anisaldehyde;Benzaldehyde, methoxy-; |
| Molecular Structure: |
 |