Details for Alpha naphthol

Alpha naphthol
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
90-15-3 |
| EC NO: |
201-969-4 |
| Molecular Formula: |
C10H8O |
| Molecular Weight: |
144.17 |
| Specification: |
|
| InChI: |
InChI=1/C10H8O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7,11H |
| Synonyms: |
C.I. 76605;C.I. Oxidation Base 33;a-Naphthol;1-Hydroxynaphthalene;Durafur developer D;Fourrine 99;Furro ER;Oxidation base 33;1-Naphthalenol;1-naphthol (alpha);alpha-Naphthol;ALPHA NAPHTHOL; |
| Molecular Structure: |
 |
if you are sourcing Alpha naphthol from China ,just feel free to inquire