Details for Solvent Blue 63

Solvent Blue 63
| Category: |
Dyestuffs and Pigments/Solvent Dyes |
|
| CAS NO: |
6408-50-0 |
| EC NO: |
229-059-2 |
| Molecular Formula: |
C22H18N2O2 |
| Molecular Weight: |
342.3905 |
| Specification: |
|
| InChI: |
InChI=1/C22H18N2O2/c1-13-6-5-7-14(12-13)24-18-11-10-17(23-2)19-20(18)22(26)16-9-4-3-8-15(16)21(19)25/h3-12,23-24H,1-2H3 |
| Synonyms: |
C.I. 61520;C.I. Solvent Blue 63;9,10-Anthracenedione, 1-(methylamino)-4-((3-methylphenyl)amino)-;1-(methylamino)-4-[(3-methylphenyl)amino]anthracene-9,10-dione; |
| Molecular Structure: |
 |
if you are sourcing Solvent Blue 63 from China ,just feel free to inquire