Details for Disperse Red 17

Disperse Red 17
| Category: |
Dyestuffs and Pigments |
|
| CAS NO: |
3179-89-3 |
| EC NO: |
221-665-5 |
| Molecular Formula: |
C17H20N4O4 |
| Molecular Weight: |
344.3651 |
| Specification: |
|
| InChI: |
InChI=1/C17H20N4O4/c1-13-2-5-16(20(8-10-22)9-11-23)12-17(13)19-18-14-3-6-15(7-4-14)21(24)25/h2-7,12,22-23H,8-11H2,1H3/b19-18+ |
| Synonyms: |
C.I. Disperse Red 17;Ethanol, 2,2'-((3-methyl-4-(2-(4-nitrophenyl)diazenyl)phenyl)imino)bis-;2,2'-({4-methyl-3-[(E)-(4-nitrophenyl)diazenyl]phenyl}imino)diethanol;Disperse Red 5B;Disperse Red 17; |
| Molecular Structure: |
 |
if you are sourcing Disperse Red 17 from China ,just feel free to inquire