| Category: |
Intermediates/Agrochemical intermediates |
|
| CAS NO: |
31037-02-2 |
| EC NO: |
|
| Molecular Formula: |
C7H11N3O2 |
| Molecular Weight: |
169.1811 |
| Specification: |
|
| InChI: |
InChI=1/C7H11N3O2/c1-3-12-7(11)5-4-9-10(2)6(5)8/h4H,3,8H2,1-2H3 |
Product description:
Commodity: 5-Amino-1-methyl-1H-pyrazole-4-carboxylic acid ethyl ester
CAS#: 31037-02-2
Molecular Formula:C7H11N3O
Structural Formula:
Uses: Medical and biological chemical,Used as a pesticide intermediates, can be directly used to synthesize sulfonamide
Specification:
Item Standard
Appearance
White crystals
Content
≥98.0%
|
| Synonyms: |
Ethyl 5-amino-1-methyl-1H-pyrazole-4-carboxylate;Ethyl 5-amino-1-methylpyrazole-4-carboxylate;5-Amino-1-methylpyrazole-4-carboxylic acid ethyl ester;Amino-1-methyl-1H-pyrazole-4-carboxylic acid ethyl ester, 5-; |
| Molecular Structure: |
 |