Details for 2-Amino-2'-methyldiphenyl ether

2-Amino-2'-methyldiphenyl ether
| Category: |
Organic chemicals and Derivatives/Aroma compounds |
|
| CAS NO: |
3840-18-4 |
| EC NO: |
223-329-3 |
| Molecular Formula: |
C13H13NO |
| Molecular Weight: |
199.2484 |
| Specification: |
|
| InChI: |
InChI=1/C13H13NO/c1-10-6-2-4-8-12(10)15-13-9-5-3-7-11(13)14/h2-9H,14H2,1H3 |
| Synonyms: |
1-13-00-00109;2-(o-Tolyloxy)aniline;BRN 2723291;NSC 163942;2-(2-Methylphenoxy)aniline;2-Amino-2'-methyldiphenyl ether;2-(2-Tolyloxy) aniline;2-(O-tolyloxy)benzenamine;2-Aminophenyl O-Tolyl Ether2-(2-Methylphenoxy)Aniline;Benzenamine, 2-(2-Methylphenoxy)-;2-Methyl-2'-Aminodiphenylether; |
| Molecular Structure: |
 |
if you are sourcing 2-Amino-2'-methyldiphenyl ether from China ,just feel free to inquire