| Category: |
Other Chemicals |
|
| CAS NO: |
12738-64-6 |
| EC NO: |
235-795-5 |
| Molecular Formula: |
C19H26O12 |
| Molecular Weight: |
446.4025 |
| Specification: |
|
| InChI: |
InChI=1/C19H26O12/c20-6-10-12(23)14(25)15(26)18(28-10)31-19(8-22)16(13(24)11(7-21)30-19)29-17(27)9-4-2-1-3-5-9/h1-5,10-16,18,20-26H,6-8H2/t10-,11-,12-,13-,14+,15-,16+,18-,19+/m1/s1 |
| Packing: |
50kgs/drum or as required by the customer. |
Product description:
Uses: Sucrose benzoate is a stable, odorless and glassy solid or white powder. It has excellent ultraviolet light stability. It has good compatibility with resins, plasticizers and solvent. Sucrose benzoate is used in ink industry, coating, modifier and plasticizer for plastics and so on. |
| Synonyms: |
-.alpha.-D-Glucopyranoside,.beta.-D-fructofuranosyl,benzoate;a-d-glucopyranoside,;a-d-glucopyranoside,?;a-d-glucopyranoside,?d-fructofuranosyl,benzoate;alpha-d-glucopyranoside,beta-d-fructofuranosyl,benzoate;Sucroseoctabenzoate;a-d-glucopyranoside,a-d-glucopyranoside;S-(-)-Tert-butylamino-1,2-propanediol ;3-O-(phenylcarbonyl)-beta-D-fructofuranosyl alpha-D-glucopyranoside; |
| Molecular Structure: |
 |