Details for 2-heptanol

2-heptanol
| Category: |
Organic chemicals and Derivatives/Alcohol and aether compounds |
|
| CAS NO: |
543-49-7 |
| EC NO: |
208-844-3 |
| Molecular Formula: |
C7H16O |
| Molecular Weight: |
116.2013 |
| Specification: |
|
| InChI: |
InChI=1/C7H16O/c1-3-4-5-6-7(2)8/h7-8H,3-6H2,1-2H3/t7-/m1/s1 |
| Synonyms: |
n-Amyl methyl carbinol~Methyl n-pentyl carbinol;2-enanthol;SEC-HEPTYL ALCOHOL;N-AMYL METHYL CARBINOL;1-methylhexanol;alcoolheptyliquesecondaire;CH3(CH2)4CHOHCH3;heptan-2-ol;heptanol(non-specificname);Heptanol-2;methylamylcarbinol(combustibleliquid,n.o.s.);methyl-n-amylcarbinol;n-Heptan-2-ol;s-Heptyl alcohol;s-heptylalcohol;2-HYDROXYHEPTANE;2-HEPTYL ALCOHOL;(2S)-heptan-2-ol;(2R)-heptan-2-ol; |
| Molecular Structure: |
 |
if you are sourcing 2-heptanol from China ,just feel free to inquire