Details for 2-Methylphenylacetic acid

2-Methylphenylacetic acid
| Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
| CAS NO: |
644-36-0 |
| EC NO: |
211-416-9 |
| Molecular Formula: |
C9H10O2 |
| Molecular Weight: |
150.176 |
| Specification: |
|
| InChI: |
InChI=1/C9H10O2/c1-7-4-2-3-5-8(7)6-9(10)11/h2-5H,6H2,1H3,(H,10,11)/p-1 |
| Synonyms: |
o-Methylphenylacetic acid;ortho-tolylacetic acid;2-methylphenylacetic acid;(2-methylphenyl)acetate;2-Tolylacetic acid; |
| Molecular Structure: |
 |
if you are sourcing 2-Methylphenylacetic acid from Belgium ,just feel free to inquire